* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | UKRORGSYN-BB BBV-34354537 |
English Synonyms: | UKRORGSYN-BB BBV-34354537 |
MDL Number.: | MFCD16805502 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(CNC)Sc1nccs1 |
InChi: | InChI=1S/C7H12N2S2/c1-6(5-8-2)11-7-9-3-4-10-7/h3-4,6,8H,5H2,1-2H3 |
InChiKey: | InChIKey=WYZDGBUPKVLBAS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.