* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354562 |
English Synonyms: | UKRORGSYN-BB BBV-34354562 |
MDL Number.: | MFCD16805527 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(C)CNCCSc1nccs1 |
InChi: | InChI=1S/C9H16N2S2/c1-8(2)7-10-3-5-12-9-11-4-6-13-9/h4,6,8,10H,3,5,7H2,1-2H3 |
InChiKey: | InChIKey=RKODZQGZPMRHLI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.