* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354639 |
English Synonyms: | UKRORGSYN-BB BBV-34354639 |
MDL Number.: | MFCD16805604 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CCC(CC)NCC(C)Sc1[nH]c(nn1)C |
InChi: | InChI=1S/C11H22N4S/c1-5-10(6-2)12-7-8(3)16-11-13-9(4)14-15-11/h8,10,12H,5-7H2,1-4H3,(H,13,14,15) |
InChiKey: | InChIKey=ACQOMANVDFLXPH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.