* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34354641 |
English Synonyms: | UKRORGSYN-BB BBV-34354641 |
MDL Number.: | MFCD16805606 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CCCCNCC(C)Sc1[nH]c(nn1)C |
InChi: | InChI=1S/C10H20N4S/c1-4-5-6-11-7-8(2)15-10-12-9(3)13-14-10/h8,11H,4-7H2,1-3H3,(H,12,13,14) |
InChiKey: | InChIKey=FIDIJVAQSUYOMX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.