* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34355327 |
English Synonyms: | UKRORGSYN-BB BBV-34355327 |
MDL Number.: | MFCD16806183 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCNCCN(C)Cc1c(ccs1)Br |
InChi: | InChI=1S/C11H19BrN2S/c1-3-5-13-6-7-14(2)9-11-10(12)4-8-15-11/h4,8,13H,3,5-7,9H2,1-2H3 |
InChiKey: | InChIKey=ODDWJNGVDTWITJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.