* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34355362 |
English Synonyms: | UKRORGSYN-BB BBV-34355362 |
MDL Number.: | MFCD16806213 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)CNCCN(C)CCn1cccn1 |
InChi: | InChI=1S/C12H24N4/c1-12(2)11-13-6-8-15(3)9-10-16-7-4-5-14-16/h4-5,7,12-13H,6,8-11H2,1-3H3 |
InChiKey: | InChIKey=CYCKEZDQAQURIG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.