* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34355380 |
English Synonyms: | UKRORGSYN-BB BBV-34355380 |
MDL Number.: | MFCD16806231 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1cc(cc(c1)C(=O)NCC(=O)N)CCN |
InChi: | InChI=1S/C11H15N3O2/c12-5-4-8-2-1-3-9(6-8)11(16)14-7-10(13)15/h1-3,6H,4-5,7,12H2,(H2,13,15)(H,14,16) |
InChiKey: | InChIKey=PPQOSEKQPGBGJS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.