* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34355894 |
English Synonyms: | UKRORGSYN-BB BBV-34355894 |
MDL Number.: | MFCD16806729 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCn1ccnc1N(C)CCNCCOC |
InChi: | InChI=1S/C11H22N4O/c1-4-15-9-6-13-11(15)14(2)8-5-12-7-10-16-3/h6,9,12H,4-5,7-8,10H2,1-3H3 |
InChiKey: | InChIKey=UOXHKSKYOYYLLF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.