* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34534262 |
English Synonyms: | UKRORGSYN-BB BBV-34534262 |
MDL Number.: | MFCD16808542 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1cscc1CC(C2CCCCCC2)N |
InChi: | InChI=1S/C13H21NS/c14-13(9-11-7-8-15-10-11)12-5-3-1-2-4-6-12/h7-8,10,12-13H,1-6,9,14H2 |
InChiKey: | InChIKey=VFOORBYIFYDBHM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.