* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34534478 |
English Synonyms: | UKRORGSYN-BB BBV-34534478 |
MDL Number.: | MFCD16808739 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC(C)[C@@H](C(=O)O)NC(=O)CCOC |
InChi: | InChI=1S/C9H17NO4/c1-6(2)8(9(12)13)10-7(11)4-5-14-3/h6,8H,4-5H2,1-3H3,(H,10,11)(H,12,13)/t8-/m0/s1 |
InChiKey: | InChIKey=QDYVKUGIDBOETD-QMMMGPOBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.