* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34534496 |
English Synonyms: | UKRORGSYN-BB BBV-34534496 |
MDL Number.: | MFCD16808756 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC(C)C[C@H](C(=O)O)NC(=O)CCOC |
InChi: | InChI=1S/C10H19NO4/c1-7(2)6-8(10(13)14)11-9(12)4-5-15-3/h7-8H,4-6H2,1-3H3,(H,11,12)(H,13,14)/t8-/m1/s1 |
InChiKey: | InChIKey=PJHLBJARJWZFNN-MRVPVSSYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.