* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-CYCLOPENTYL-5-(2-METHOXYETHYL)-1H-1,2,4-TRIAZOLE |
| English Synonyms: | 3-CYCLOPENTYL-5-(2-METHOXYETHYL)-1H-1,2,4-TRIAZOLE |
| MDL Number.: | MFCD16808905 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | COCCc1[nH]nc(n1)C2CCCC2 |
| InChi: | InChI=1S/C10H17N3O/c1-14-7-6-9-11-10(13-12-9)8-4-2-3-5-8/h8H,2-7H2,1H3,(H,11,12,13) |
| InChiKey: | InChIKey=BBFCSJDIEMGQNQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.