* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-[5-(2-METHOXYETHYL)-1,2,4-OXADIAZOL-3-YL]ANILINE |
| English Synonyms: | 3-[5-(2-METHOXYETHYL)-1,2,4-OXADIAZOL-3-YL]ANILINE |
| MDL Number.: | MFCD16808965 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | COCCc1nc(no1)c2cccc(c2)N |
| InChi: | InChI=1S/C11H13N3O2/c1-15-6-5-10-13-11(14-16-10)8-3-2-4-9(12)7-8/h2-4,7H,5-6,12H2,1H3 |
| InChiKey: | InChIKey=XERDWVQTALSADC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.