* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34534935 |
English Synonyms: | UKRORGSYN-BB BBV-34534935 |
MDL Number.: | MFCD16809179 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCOCCC(=O)N[C@@H](C)C(=O)O |
InChi: | InChI=1S/C8H15NO4/c1-3-13-5-4-7(10)9-6(2)8(11)12/h6H,3-5H2,1-2H3,(H,9,10)(H,11,12)/t6-/m0/s1 |
InChiKey: | InChIKey=QBIALAQBYQTLNV-LURJTMIESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.