* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34534942 |
English Synonyms: | UKRORGSYN-BB BBV-34534942 |
MDL Number.: | MFCD16809185 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | CCOCCC(=O)N[C@@H](CO)C(=O)O |
InChi: | InChI=1S/C8H15NO5/c1-2-14-4-3-7(11)9-6(5-10)8(12)13/h6,10H,2-5H2,1H3,(H,9,11)(H,12,13)/t6-/m0/s1 |
InChiKey: | InChIKey=NCMBBWQOGKHCAN-LURJTMIESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.