* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34535073 |
English Synonyms: | UKRORGSYN-BB BBV-34535073 |
MDL Number.: | MFCD16809303 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CCOCCc1nnc2n1nc(cc2)Cl |
InChi: | InChI=1S/C9H11ClN4O/c1-2-15-6-5-9-12-11-8-4-3-7(10)13-14(8)9/h3-4H,2,5-6H2,1H3 |
InChiKey: | InChIKey=JWHOUGIZYVOQRX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.