* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34535180 |
English Synonyms: | UKRORGSYN-BB BBV-34535180 |
MDL Number.: | MFCD16809405 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | CCOCCC(=O)NC(C)(C)/C(=N/O)/N |
InChi: | InChI=1S/C9H19N3O3/c1-4-15-6-5-7(13)11-9(2,3)8(10)12-14/h14H,4-6H2,1-3H3,(H2,10,12)(H,11,13) |
InChiKey: | InChIKey=HVVDBQWDEAHSHN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.