* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34535181 |
English Synonyms: | UKRORGSYN-BB BBV-34535181 |
MDL Number.: | MFCD16809406 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | CCOCCC(=O)NC/C(=N/O)/N |
InChi: | InChI=1S/C7H15N3O3/c1-2-13-4-3-7(11)9-5-6(8)10-12/h12H,2-5H2,1H3,(H2,8,10)(H,9,11) |
InChiKey: | InChIKey=RDHXDUVZRXIYOI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.