* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(3-AMINO-1H-PYRAZOL-1-YL)BUTAN-2-ONE |
| English Synonyms: | 3-(3-AMINO-1H-PYRAZOL-1-YL)BUTAN-2-ONE |
| MDL Number.: | MFCD16810836 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | NC1=NN(C=C1)C(C(C)=O)C |
| InChi: | InChI=1S/C7H11N3O/c1-5(6(2)11)10-4-3-7(8)9-10/h3-5H,1-2H3,(H2,8,9) |
| InChiKey: | InChIKey=DCFDDUBINIHICW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.