* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH1147593 |
| English Synonyms: | FCHGROUP FCH1147593 |
| MDL Number.: | MFCD16810847 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)/C=C/Cn2ccc(n2)N |
| InChi: | InChI=1S/C12H13N3/c13-12-8-10-15(14-12)9-4-7-11-5-2-1-3-6-11/h1-8,10H,9H2,(H2,13,14)/b7-4+ |
| InChiKey: | InChIKey=IMIXWYTYMYFNLW-QPJJXVBHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.