* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-[(3,5-DIMETHYLPHENYL)METHYL]-1,2,4-THIADIAZOL-5-AMINE |
| English Synonyms: | 3-[(3,5-DIMETHYLPHENYL)METHYL]-1,2,4-THIADIAZOL-5-AMINE |
| MDL Number.: | MFCD16817847 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1cc(cc(c1)Cc2nc(sn2)N)C |
| InChi: | InChI=1S/C11H13N3S/c1-7-3-8(2)5-9(4-7)6-10-13-11(12)15-14-10/h3-5H,6H2,1-2H3,(H2,12,13,14) |
| InChiKey: | InChIKey=JMCRWLYHNAUJSC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.