* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(2-PHENOXYETHYL)-1,2,4-OXADIAZOL-5-AMINE |
| English Synonyms: | 3-(2-PHENOXYETHYL)-1,2,4-OXADIAZOL-5-AMINE |
| MDL Number.: | MFCD16817913 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)OCCc2nc(on2)N |
| InChi: | InChI=1S/C10H11N3O2/c11-10-12-9(13-15-10)6-7-14-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,11,12,13) |
| InChiKey: | InChIKey=ADZROQMSLLNDJE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.