* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-BENZYL-N-METHYL-1,2,4-OXADIAZOL-5-AMINE |
| English Synonyms: | 3-BENZYL-N-METHYL-1,2,4-OXADIAZOL-5-AMINE |
| MDL Number.: | MFCD16817918 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CNc1nc(no1)Cc2ccccc2 |
| InChi: | InChI=1S/C10H11N3O/c1-11-10-12-9(13-14-10)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,11,12,13) |
| InChiKey: | InChIKey=PHFBMXWFKMEGPF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.