* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(2-METHOXYETHYL)-N-METHYL-1,2,4-OXADIAZOL-5-AMINE |
| English Synonyms: | 3-(2-METHOXYETHYL)-N-METHYL-1,2,4-OXADIAZOL-5-AMINE |
| MDL Number.: | MFCD16817948 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CNc1nc(no1)CCOC |
| InChi: | InChI=1S/C6H11N3O2/c1-7-6-8-5(9-11-6)3-4-10-2/h3-4H2,1-2H3,(H,7,8,9) |
| InChiKey: | InChIKey=MFEOOWSILWPWJZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.