* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6028149 |
English Synonyms: | ABAMACHEM ABA-6028149 |
MDL Number.: | MFCD16832872 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc(c(c1)S(=O)(=O)NCCCC#N)Cl |
InChi: | InChI=1S/C10H11ClN2O2S/c11-9-5-1-2-6-10(9)16(14,15)13-8-4-3-7-12/h1-2,5-6,13H,3-4,8H2 |
InChiKey: | InChIKey=RSYYSPMQFMNWQO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.