* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH773601 |
English Synonyms: | FCHGROUP FCH773601 |
MDL Number.: | MFCD16832874 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(cc(c1)Cl)S(=O)(=O)NCCCC#N |
InChi: | InChI=1S/C10H11ClN2O2S/c11-9-4-3-5-10(8-9)16(14,15)13-7-2-1-6-12/h3-5,8,13H,1-2,7H2 |
InChiKey: | InChIKey=BSJNHPNUVJYKMG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.