* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SELENA SEL10871686 |
English Synonyms: | SELENA SEL10871686 |
MDL Number.: | MFCD16832880 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cn1cc(cn1)S(=O)(=O)NCCCC#N |
InChi: | InChI=1S/C8H12N4O2S/c1-12-7-8(6-10-12)15(13,14)11-5-3-2-4-9/h6-7,11H,2-3,5H2,1H3 |
InChiKey: | InChIKey=FAUSFIVLPRDWSH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.