* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6028151 |
English Synonyms: | ABAMACHEM ABA-6028151 |
MDL Number.: | MFCD16832881 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cc1nc(cn1C)S(=O)(=O)NCCCC#N |
InChi: | InChI=1S/C9H14N4O2S/c1-8-12-9(7-13(8)2)16(14,15)11-6-4-3-5-10/h7,11H,3-4,6H2,1-2H3 |
InChiKey: | InChIKey=RHDWQKWNEOYKHT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.