* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH773603 |
English Synonyms: | FCHGROUP FCH773603 |
MDL Number.: | MFCD16832883 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | C1CCC(CC1)S(=O)(=O)NCCCC#N |
InChi: | InChI=1S/C10H18N2O2S/c11-8-4-5-9-12-15(13,14)10-6-2-1-3-7-10/h10,12H,1-7,9H2 |
InChiKey: | InChIKey=KZBLBTKJRPQQJR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.