* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-(3-AMINO-2-METHYLPROPYL)-5H,6H,7H-PYRROLO[3,4-B]PYRIDINE-5,7-DIONE |
English Synonyms: | 6-(3-AMINO-2-METHYLPROPYL)-5H,6H,7H-PYRROLO[3,4-B]PYRIDINE-5,7-DIONE |
MDL Number.: | MFCD16833253 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(CN)CN1C(=O)c2cccnc2C1=O |
InChi: | InChI=1S/C11H13N3O2/c1-7(5-12)6-14-10(15)8-3-2-4-13-9(8)11(14)16/h2-4,7H,5-6,12H2,1H3 |
InChiKey: | InChIKey=MZGGTMWSLNKNCR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.