* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH773645 |
| English Synonyms: | FCHGROUP FCH773645 |
| MDL Number.: | MFCD16833990 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | C1CS(=O)(=O)CCC1S(=O)(=O)NCCC#N |
| InChi: | InChI=1S/C8H14N2O4S2/c9-4-1-5-10-16(13,14)8-2-6-15(11,12)7-3-8/h8,10H,1-3,5-7H2 |
| InChiKey: | InChIKey=UMOOJGLSUVQURX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.