* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6028195 |
English Synonyms: | ABAMACHEM ABA-6028195 |
MDL Number.: | MFCD16834005 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCc1ccc(s1)S(=O)(=O)NCCC#N |
InChi: | InChI=1S/C9H12N2O2S2/c1-2-8-4-5-9(14-8)15(12,13)11-7-3-6-10/h4-5,11H,2-3,7H2,1H3 |
InChiKey: | InChIKey=WLTJDIFMUFCXAA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.