* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6294753 |
English Synonyms: | ABAMACHEM ABA-6294753 |
MDL Number.: | MFCD16834019 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(CNS(=O)(=O)c1ccc(s1)Br)C#N |
InChi: | InChI=1S/C8H9BrN2O2S2/c1-6(4-10)5-11-15(12,13)8-3-2-7(9)14-8/h2-3,6,11H,5H2,1H3 |
InChiKey: | InChIKey=OOFQSGYZYFRTDP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.