* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-6028197 |
English Synonyms: | ABAMACHEM ABA-6028197 |
MDL Number.: | MFCD16834020 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(CNS(=O)(=O)c1cc(sc1Cl)Cl)C#N |
InChi: | InChI=1S/C8H8Cl2N2O2S2/c1-5(3-11)4-12-16(13,14)6-2-7(9)15-8(6)10/h2,5,12H,4H2,1H3 |
InChiKey: | InChIKey=JXYZDMPMMWWITF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.