* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC675324 |
| English Synonyms: | BCH-RESEARCH BC675324 |
| MDL Number.: | MFCD16834021 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC(CNS(=O)(=O)c1ccc(s1)Cl)C#N |
| InChi: | InChI=1S/C8H9ClN2O2S2/c1-6(4-10)5-11-15(12,13)8-3-2-7(9)14-8/h2-3,6,11H,5H2,1H3 |
| InChiKey: | InChIKey=KXNALEJDSCUYOF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.