* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH773649 |
English Synonyms: | FCHGROUP FCH773649 |
MDL Number.: | MFCD16834023 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | Cc1c(cn[nH]1)S(=O)(=O)NCC(C)C#N |
InChi: | InChI=1S/C8H12N4O2S/c1-6(3-9)4-11-15(13,14)8-5-10-12-7(8)2/h5-6,11H,4H2,1-2H3,(H,10,12) |
InChiKey: | InChIKey=PPXLFXJFARBREM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.