* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10871733 |
| English Synonyms: | SELENA SEL10871733 |
| MDL Number.: | MFCD16834024 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(CNS(=O)(=O)C1CCOCC1)C#N |
| InChi: | InChI=1S/C9H16N2O3S/c1-8(6-10)7-11-15(12,13)9-2-4-14-5-3-9/h8-9,11H,2-5,7H2,1H3 |
| InChiKey: | InChIKey=LUFMXDOREXRJEI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.