Molecular Structure:
CCD No.:CCD03214099
SELENA SEL10871734
Formula:C10 H18 N2 O2 S
MolWeight:230.33
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10871734 |
| English Synonyms： | SELENA SEL10871734 |
| MDL Number.： | MFCD16834028 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CC(CNS(=O)(=O)C1CCCCC1)C#N |
| InChi： | InChI=1S/C10H18N2O2S/c1-9(7-11)8-12-15(13,14)10-5-3-2-4-6-10/h9-10,12H,2-6,8H2,1H3 |
| InChiKey： | InChIKey=CQZGCUKJKMKXPC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
