* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC675327 |
| English Synonyms: | BCH-RESEARCH BC675327 |
| MDL Number.: | MFCD16834037 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(CNS(=O)(=O)c1cc(cnc1)F)C#N |
| InChi: | InChI=1S/C9H10FN3O2S/c1-7(3-11)4-13-16(14,15)9-2-8(10)5-12-6-9/h2,5-7,13H,4H2,1H3 |
| InChiKey: | InChIKey=YMIZXZWSKQZJLA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.