* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH773652 |
| English Synonyms: | FCHGROUP FCH773652 |
| MDL Number.: | MFCD16834039 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCc1ccc(s1)S(=O)(=O)NCC(C)C#N |
| InChi: | InChI=1S/C10H14N2O2S2/c1-3-9-4-5-10(15-9)16(13,14)12-7-8(2)6-11/h4-5,8,12H,3,7H2,1-2H3 |
| InChiKey: | InChIKey=JCYUIHONDBENME-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.