* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC675331 |
| English Synonyms: | BCH-RESEARCH BC675331 |
| MDL Number.: | MFCD16834062 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(CNS(=O)(=O)c1cccnc1)C#N |
| InChi: | InChI=1S/C9H11N3O2S/c1-8(5-10)6-12-15(13,14)9-3-2-4-11-7-9/h2-4,7-8,12H,6H2,1H3 |
| InChiKey: | InChIKey=OUJNAOZKFKCTPL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.