* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | METHYL((1-[2-(2-METHYLPROPYL)-1,3-THIAZOL-5-YL]ETHYL))AMINE |
| English Synonyms: | METHYL((1-[2-(2-METHYLPROPYL)-1,3-THIAZOL-5-YL]ETHYL))AMINE |
| MDL Number.: | MFCD16834537 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(C)Cc1ncc(s1)C(C)NC |
| InChi: | InChI=1S/C10H18N2S/c1-7(2)5-10-12-6-9(13-10)8(3)11-4/h6-8,11H,5H2,1-4H3 |
| InChiKey: | InChIKey=FPIDIGVBWMJGND-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.