* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ETHYL[1-(2-METHYL-1,3-THIAZOL-5-YL)ETHYL]AMINE |
English Synonyms: | ETHYL[1-(2-METHYL-1,3-THIAZOL-5-YL)ETHYL]AMINE |
MDL Number.: | MFCD16834576 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCNC(C)c1cnc(s1)C |
InChi: | InChI=1S/C8H14N2S/c1-4-9-6(2)8-5-10-7(3)11-8/h5-6,9H,4H2,1-3H3 |
InChiKey: | InChIKey=RZXPKYOYYYNDDZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.