* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL((1-[2-(4H-1,2,4-TRIAZOL-3-YL)-1,3-THIAZOL-5-YL]ETHYL))AMINE |
| English Synonyms: | PROPYL((1-[2-(4H-1,2,4-TRIAZOL-3-YL)-1,3-THIAZOL-5-YL]ETHYL))AMINE |
| MDL Number.: | MFCD16834602 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CCCNC(C)c1cnc(s1)c2[nH]cnn2 |
| InChi: | InChI=1S/C10H15N5S/c1-3-4-11-7(2)8-5-12-10(16-8)9-13-6-14-15-9/h5-7,11H,3-4H2,1-2H3,(H,13,14,15) |
| InChiKey: | InChIKey=ZFJBWCIMEKZTJD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.