* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL((1-[2-(THIOPHEN-3-YL)-1,3-THIAZOL-5-YL]ETHYL))AMINE |
| English Synonyms: | PROPYL((1-[2-(THIOPHEN-3-YL)-1,3-THIAZOL-5-YL]ETHYL))AMINE |
| MDL Number.: | MFCD16834610 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCNC(C)c1cnc(s1)c2ccsc2 |
| InChi: | InChI=1S/C12H16N2S2/c1-3-5-13-9(2)11-7-14-12(16-11)10-4-6-15-8-10/h4,6-9,13H,3,5H2,1-2H3 |
| InChiKey: | InChIKey=HBQDRROBOBUGNF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.