* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL[1-(2-PROPYL-1,3-THIAZOL-5-YL)ETHYL]AMINE |
| English Synonyms: | PROPYL[1-(2-PROPYL-1,3-THIAZOL-5-YL)ETHYL]AMINE |
| MDL Number.: | MFCD16834611 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCc1ncc(s1)C(C)NCCC |
| InChi: | InChI=1S/C11H20N2S/c1-4-6-11-13-8-10(14-11)9(3)12-7-5-2/h8-9,12H,4-7H2,1-3H3 |
| InChiKey: | InChIKey=FBRLEDABDATYMW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.