* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PROPYL[1-(1,3-THIAZOL-5-YL)ETHYL]AMINE |
English Synonyms: | PROPYL[1-(1,3-THIAZOL-5-YL)ETHYL]AMINE |
MDL Number.: | MFCD16834612 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCNC(C)c1cncs1 |
InChi: | InChI=1S/C8H14N2S/c1-3-4-10-7(2)8-5-9-6-11-8/h5-7,10H,3-4H2,1-2H3 |
InChiKey: | InChIKey=QVHXHNXVDGCHEX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.