* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PROPYL((1-[2-(2,2,2-TRIFLUOROETHYL)-1,3-THIAZOL-5-YL]ETHYL))AMINE |
English Synonyms: | PROPYL((1-[2-(2,2,2-TRIFLUOROETHYL)-1,3-THIAZOL-5-YL]ETHYL))AMINE |
MDL Number.: | MFCD16834614 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCNC(C)c1cnc(s1)CC(F)(F)F |
InChi: | InChI=1S/C10H15F3N2S/c1-3-4-14-7(2)8-6-15-9(16-8)5-10(11,12)13/h6-7,14H,3-5H2,1-2H3 |
InChiKey: | InChIKey=TYLFHGREZAEZHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.