* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10871762 |
| English Synonyms: | SELENA SEL10871762 |
| MDL Number.: | MFCD16835207 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCC(CC#N)NS(=O)(=O)c1ccc(s1)Cl |
| InChi: | InChI=1S/C9H11ClN2O2S2/c1-2-7(5-6-11)12-16(13,14)9-4-3-8(10)15-9/h3-4,7,12H,2,5H2,1H3 |
| InChiKey: | InChIKey=JPDVIQLCOZJJFJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.