* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10871763 |
| English Synonyms: | SELENA SEL10871763 |
| MDL Number.: | MFCD16835212 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCC(CC#N)NS(=O)(=O)c1cn(cn1)C |
| InChi: | InChI=1S/C9H14N4O2S/c1-3-8(4-5-10)12-16(14,15)9-6-13(2)7-11-9/h6-8,12H,3-4H2,1-2H3 |
| InChiKey: | InChIKey=YLGURZJXYAVSEG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.